322-46-3 Pyrido[2,3-b]pyrazine
| ??? ?????? |
Pyrido[2,3-b]pyrazine |
| ????? ??????????? |
Pyrido[2,3-b]pyrazine; 1,4,5-Triazanaphthalene; Pyrido(2,3-b)pyrazine; Pyridopyrazine |
| ?????? ???????? |
C7H5N3 |
| ????? ??????? ??????? |
131.1347 |
| InChI |
InChI=1/C7H5N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-5H |
| ?????????? ???????? ??????? |
322-46-3 |
| ???????? ????????? ??? |
206-294-9 |
| ???? ?????? |
|
| ????? |
1.27g/cm3 |
| ???? ???????? |
139-143℃ |
| ???? ??????? |
253.9°C at 760 mmHg |
| ????? ???????? |
1.665 |
| ???? ?????? |
115.9°C |
| ??? ?????? |
0.0284mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xn:Harmful;
|
| ??? ????????? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|